C17H23N3O2 — CID 108519444
N-(4-cyanophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide (PubChem CID 108519444) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide.
| Compound Name | N-(4-cyanophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 108519444 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-(4-cyanophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H23N3O2/c1-16(2,3)11-17(4,5)20-15(22)14(21)19-13-8-6-12(10-18)7-9-13/h6-9H,11H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | WFEMJTLKEPKLSI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|