C19H28N2O4 — CID 108500106
ethyl 4-[[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]benzoate (PubChem CID 108500106) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl 4-[[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 108500106 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | ethyl 4-[[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NC(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28N2O4/c1-7-25-17(24)13-8-10-14(11-9-13)20-15(22)16(23)21-19(5,6)12-18(2,3)4/h8-11H,7,12H2,1-6H3,(H,20,22)(H,21,23) |
| InChIKey | XSWFFKYUWMCTIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|