C22H24N2O5 — CID 108969766
ethyl 4-[[3-(4-acetylanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate (PubChem CID 108969766) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is ethyl 4-[[3-(4-acetylanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(4-acetylanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108969766 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | ethyl 4-[[3-(4-acetylanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)(C)C(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-5-29-19(26)16-8-12-18(13-9-16)24-21(28)22(3,4)20(27)23-17-10-6-15(7-11-17)14(2)25/h6-13H,5H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | AGGAUTUWKLXKHW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|