C18H17N3O5 — CID 108500149
ethyl 4-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate (PubChem CID 108500149) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108500149 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl 4-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O5/c1-2-26-18(25)12-5-9-14(10-6-12)20-16(23)17(24)21-15(22)11-3-7-13(19)8-4-11/h3-10H,2,19H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | OACBEWKZVWVPDV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|