About 4-amino-N-(4-aminophenyl)benzamide;ethanamine
4-amino-N-(4-aminophenyl)benzamide;ethanamine (PubChem CID 19078068) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-amino-N-(4-aminophenyl)benzamide;ethanamine.
Molecular Properties
| Compound Name | 4-amino-N-(4-aminophenyl)benzamide;ethanamine |
| PubChem CID | 19078068 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-amino-N-(4-aminophenyl)benzamide;ethanamine |
| SMILES | CCN.Nc1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H13N3O.C2H7N/c14-10-3-1-9(2-4-10)13(17)16-12-7-5-11(15)6-8-12;1-2-3/h1-8H,14-15H2,(H,16,17);2-3H2,1H3 |
| InChIKey | QIPCQNAJANHRDY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(4-aminophenyl)benzamide;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(4-aminophenyl)benzamide;ethanamine?
The IUPAC name of 4-amino-N-(4-aminophenyl)benzamide;ethanamine (CID 19078068) is 4-amino-N-(4-aminophenyl)benzamide;ethanamine.
What is the SMILES notation for 4-amino-N-(4-aminophenyl)benzamide;ethanamine?
The canonical SMILES for 4-amino-N-(4-aminophenyl)benzamide;ethanamine is CCN.Nc1ccc(NC(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of 4-amino-N-(4-aminophenyl)benzamide;ethanamine?
The InChIKey is QIPCQNAJANHRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O.C2H7N/c14-10-3-1-9(2-4-10)13(17)16-12-7-5-11(15)6-8-12;1-2-3/h1-8H,14-15H2,(H,16,17);2-3H2,1H3.
What are the key properties of 4-amino-N-(4-aminophenyl)benzamide;ethanamine?
4-amino-N-(4-aminophenyl)benzamide;ethanamine has a molecular weight of 272.35 g/mol, XLogP of 2.07, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(4-aminophenyl)benzamide;ethanamine is sourced from PubChem (CID 19078068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).