C21H28N2O2 — CID 144512975
N-(4-aminophenyl)-4-(2-methylpropanoyl)benzamide;2-methylpropane (PubChem CID 144512975) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-(2-methylpropanoyl)benzamide;2-methylpropane.
| Compound Name | N-(4-aminophenyl)-4-(2-methylpropanoyl)benzamide;2-methylpropane |
|---|---|
| PubChem CID | 144512975 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-(4-aminophenyl)-4-(2-methylpropanoyl)benzamide;2-methylpropane |
| SMILES | CC(C)C.CC(C)C(=O)c1ccc(C(=O)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O2.C4H10/c1-11(2)16(20)12-3-5-13(6-4-12)17(21)19-15-9-7-14(18)8-10-15;1-4(2)3/h3-11H,18H2,1-2H3,(H,19,21);4H,1-3H3 |
| InChIKey | UGMCWKYRKWKPCU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|