C18H27N3O2 — CID 145495797
4-amino-N-(4-hydroxyphenyl)benzamide;N-methylmethanamine;propane (PubChem CID 145495797) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxyphenyl)benzamide;N-methylmethanamine;propane.
| Compound Name | 4-amino-N-(4-hydroxyphenyl)benzamide;N-methylmethanamine;propane |
|---|---|
| PubChem CID | 145495797 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 4-amino-N-(4-hydroxyphenyl)benzamide;N-methylmethanamine;propane |
| SMILES | CCC.CNC.Nc1ccc(C(=O)Nc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C13H12N2O2.C3H8.C2H7N/c14-10-3-1-9(2-4-10)13(17)15-11-5-7-12(16)8-6-11;2*1-3-2/h1-8,16H,14H2,(H,15,17);3H2,1-2H3;3H,1-2H3 |
| InChIKey | BEBFSPHSOBWGPS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|