C15H15NO2S — CID 51193769
N-(4-hydroxyphenyl)-4-(methylsulfanylmethyl)benzamide (PubChem CID 51193769) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-4-(methylsulfanylmethyl)benzamide.
| Compound Name | N-(4-hydroxyphenyl)-4-(methylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 51193769 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-(4-hydroxyphenyl)-4-(methylsulfanylmethyl)benzamide |
| SMILES | CSCc1ccc(C(=O)Nc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H15NO2S/c1-19-10-11-2-4-12(5-3-11)15(18)16-13-6-8-14(17)9-7-13/h2-9,17H,10H2,1H3,(H,16,18) |
| InChIKey | GOWOYAYULFGFRR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|