C23H24N2OS — CID 55986022
4-(methylsulfanylmethyl)-N-[4-(1-phenylethylamino)phenyl]benzamide (PubChem CID 55986022) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 4-(methylsulfanylmethyl)-N-[4-(1-phenylethylamino)phenyl]benzamide.
| Compound Name | 4-(methylsulfanylmethyl)-N-[4-(1-phenylethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55986022 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-(methylsulfanylmethyl)-N-[4-(1-phenylethylamino)phenyl]benzamide |
| SMILES | CSCc1ccc(C(=O)Nc2ccc(NC(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2OS/c1-17(19-6-4-3-5-7-19)24-21-12-14-22(15-13-21)25-23(26)20-10-8-18(9-11-20)16-27-2/h3-15,17,24H,16H2,1-2H3,(H,25,26) |
| InChIKey | UNBZCZMWOSYLST-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |