C22H22N2O — CID 17476101
N-phenyl-4-[(1-phenylethylamino)methyl]benzamide (PubChem CID 17476101) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is N-phenyl-4-[(1-phenylethylamino)methyl]benzamide.
| Compound Name | N-phenyl-4-[(1-phenylethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 17476101 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-phenyl-4-[(1-phenylethylamino)methyl]benzamide |
| SMILES | CC(NCc1ccc(C(=O)Nc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O/c1-17(19-8-4-2-5-9-19)23-16-18-12-14-20(15-13-18)22(25)24-21-10-6-3-7-11-21/h2-15,17,23H,16H2,1H3,(H,24,25) |
| InChIKey | DRXRKRLRCUCMSJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |