C32H26N4O3 — CID 139769454
1-N,3-N-bis[4-(4-aminophenyl)phenyl]-5-hydroxybenzene-1,3-dicarboxamide (PubChem CID 139769454) has the molecular formula C32H26N4O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(4-aminophenyl)phenyl]-5-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-(4-aminophenyl)phenyl]-5-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139769454 |
| Molecular Formula | C32H26N4O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-N,3-N-bis[4-(4-aminophenyl)phenyl]-5-hydroxybenzene-1,3-dicarboxamide |
| SMILES | Nc1ccc(-c2ccc(NC(=O)c3cc(O)cc(C(=O)Nc4ccc(-c5ccc(N)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C32H26N4O3/c33-26-9-1-20(2-10-26)22-5-13-28(14-6-22)35-31(38)24-17-25(19-30(37)18-24)32(39)36-29-15-7-23(8-16-29)21-3-11-27(34)12-4-21/h1-19,37H,33-34H2,(H,35,38)(H,36,39) |
| InChIKey | HNQMBEKJIKNOSE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|