C17H19NO3 — CID 103891366
N-(4-tert-butylphenyl)-3,5-dihydroxybenzamide (PubChem CID 103891366) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(4-tert-butylphenyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 103891366 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(4-tert-butylphenyl)-3,5-dihydroxybenzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-17(2,3)12-4-6-13(7-5-12)18-16(21)11-8-14(19)10-15(20)9-11/h4-10,19-20H,1-3H3,(H,18,21) |
| InChIKey | SOZMELBOQURZTE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |