C14H12BrNO3 — CID 107706046
N-[4-(bromomethyl)phenyl]-3,5-dihydroxybenzamide (PubChem CID 107706046) has the molecular formula C14H12BrNO3 and a molecular weight of 322.16 g/mol. Its IUPAC name is N-[4-(bromomethyl)phenyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[4-(bromomethyl)phenyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107706046 |
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[4-(bromomethyl)phenyl]-3,5-dihydroxybenzamide |
| SMILES | O=C(Nc1ccc(CBr)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H12BrNO3/c15-8-9-1-3-11(4-2-9)16-14(19)10-5-12(17)7-13(18)6-10/h1-7,17-18H,8H2,(H,16,19) |
| InChIKey | JHVNIRIWPFAHJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|