C13H10FNO3 — CID 103891338
N-(4-fluorophenyl)-3,5-dihydroxybenzamide (PubChem CID 103891338) has the molecular formula C13H10FNO3 and a molecular weight of 247.23 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(4-fluorophenyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 103891338 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-(4-fluorophenyl)-3,5-dihydroxybenzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H10FNO3/c14-9-1-3-10(4-2-9)15-13(18)8-5-11(16)7-12(17)6-8/h1-7,16-17H,(H,15,18) |
| InChIKey | CDHJPNCLFBGKGX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |