C14H12FNO3 — CID 104938981
N-(4-fluoro-3-methylphenyl)-3,5-dihydroxybenzamide (PubChem CID 104938981) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104938981 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-3,5-dihydroxybenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(O)cc(O)c2)ccc1F |
| InChI | InChI=1S/C14H12FNO3/c1-8-4-10(2-3-13(8)15)16-14(19)9-5-11(17)7-12(18)6-9/h2-7,17-18H,1H3,(H,16,19) |
| InChIKey | NHXZJGNRBGLRHZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |