C22H22N4O3 — CID 139753115
1-N,3-N-bis(3-amino-4-methylphenyl)-5-hydroxybenzene-1,3-dicarboxamide (PubChem CID 139753115) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-N,3-N-bis(3-amino-4-methylphenyl)-5-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-amino-4-methylphenyl)-5-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139753115 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-N,3-N-bis(3-amino-4-methylphenyl)-5-hydroxybenzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(O)cc(C(=O)Nc3ccc(C)c(N)c3)c2)cc1N |
| InChI | InChI=1S/C22H22N4O3/c1-12-3-5-16(10-19(12)23)25-21(28)14-7-15(9-18(27)8-14)22(29)26-17-6-4-13(2)20(24)11-17/h3-11,27H,23-24H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | LKQMMQQLTFOTDL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|