C34H30N4O5 — CID 19832585
1-N,3-N-bis[3-(4-aminophenoxy)-4-methylphenyl]-5-hydroxybenzene-1,3-dicarboxamide (PubChem CID 19832585) has the molecular formula C34H30N4O5 and a molecular weight of 574.64 g/mol. Its IUPAC name is 1-N,3-N-bis[3-(4-aminophenoxy)-4-methylphenyl]-5-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[3-(4-aminophenoxy)-4-methylphenyl]-5-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19832585 |
| Molecular Formula | C34H30N4O5 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 1-N,3-N-bis[3-(4-aminophenoxy)-4-methylphenyl]-5-hydroxybenzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(O)cc(C(=O)Nc3ccc(C)c(Oc4ccc(N)cc4)c3)c2)cc1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C34H30N4O5/c1-20-3-9-26(18-31(20)42-29-11-5-24(35)6-12-29)37-33(40)22-15-23(17-28(39)16-22)34(41)38-27-10-4-21(2)32(19-27)43-30-13-7-25(36)8-14-30/h3-19,39H,35-36H2,1-2H3,(H,37,40)(H,38,41) |
| InChIKey | ZDGYWJDHALPTGK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|