C12H11N3O3 — CID 63215140
N-(4-aminophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 63215140) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-(4-aminophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 63215140 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(4-aminophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2cc(O)[nH]c(=O)c2)cc1 |
| InChI | InChI=1S/C12H11N3O3/c13-8-1-3-9(4-2-8)14-12(18)7-5-10(16)15-11(17)6-7/h1-6H,13H2,(H,14,18)(H2,15,16,17) |
| InChIKey | RCDQPWBQNQFLEU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|