C13H12N2O4 — CID 61269753
2-hydroxy-N-(2-hydroxy-4-methylphenyl)-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 61269753) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-hydroxy-N-(2-hydroxy-4-methylphenyl)-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 2-hydroxy-N-(2-hydroxy-4-methylphenyl)-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61269753 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-hydroxy-N-(2-hydroxy-4-methylphenyl)-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(O)[nH]c(=O)c2)c(O)c1 |
| InChI | InChI=1S/C13H12N2O4/c1-7-2-3-9(10(16)4-7)14-13(19)8-5-11(17)15-12(18)6-8/h2-6,16H,1H3,(H,14,19)(H2,15,17,18) |
| InChIKey | CEVSOSVHYLNJCG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|