C12H8FIN2O3 — CID 114258592
N-(3-fluoro-2-iodophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 114258592) has the molecular formula C12H8FIN2O3 and a molecular weight of 374.11 g/mol. Its IUPAC name is N-(3-fluoro-2-iodophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-(3-fluoro-2-iodophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114258592 |
| Molecular Formula | C12H8FIN2O3 |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | N-(3-fluoro-2-iodophenyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1I)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C12H8FIN2O3/c13-7-2-1-3-8(11(7)14)15-12(19)6-4-9(17)16-10(18)5-6/h1-5H,(H,15,19)(H2,16,17,18) |
| InChIKey | SQSOTMPTYSNSKV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|