C15H14N2O3 — CID 30828617
3-N-(2-hydroxy-4-methylphenyl)benzene-1,3-dicarboxamide (PubChem CID 30828617) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-N-(2-hydroxy-4-methylphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2-hydroxy-4-methylphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 30828617 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-N-(2-hydroxy-4-methylphenyl)benzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(N)=O)c2)c(O)c1 |
| InChI | InChI=1S/C15H14N2O3/c1-9-5-6-12(13(18)7-9)17-15(20)11-4-2-3-10(8-11)14(16)19/h2-8,18H,1H3,(H2,16,19)(H,17,20) |
| InChIKey | VROMLISHRJLDMN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|