C13H12N2O4 — CID 54897744
2-hydroxy-N-[3-(hydroxymethyl)phenyl]-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 54897744) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-hydroxy-N-[3-(hydroxymethyl)phenyl]-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 2-hydroxy-N-[3-(hydroxymethyl)phenyl]-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 54897744 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-hydroxy-N-[3-(hydroxymethyl)phenyl]-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(CO)c1)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C13H12N2O4/c16-7-8-2-1-3-10(4-8)14-13(19)9-5-11(17)15-12(18)6-9/h1-6,16H,7H2,(H,14,19)(H2,15,17,18) |
| InChIKey | XSFTXEAXMMIMKA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |