C12H10BrNO3 — CID 110910883
5-bromo-N-[3-(hydroxymethyl)phenyl]furan-3-carboxamide (PubChem CID 110910883) has the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. Its IUPAC name is 5-bromo-N-[3-(hydroxymethyl)phenyl]furan-3-carboxamide.
| Compound Name | 5-bromo-N-[3-(hydroxymethyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 110910883 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 5-bromo-N-[3-(hydroxymethyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1cccc(CO)c1)c1coc(Br)c1 |
| InChI | InChI=1S/C12H10BrNO3/c13-11-5-9(7-17-11)12(16)14-10-3-1-2-8(4-10)6-15/h1-5,7,15H,6H2,(H,14,16) |
| InChIKey | GUCCRQZYBUJTBA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |