C9H12NO5P — CID 54125815
[2-[3-(hydroxymethyl)anilino]-2-oxoethyl]phosphonic acid (PubChem CID 54125815) has the molecular formula C9H12NO5P and a molecular weight of 245.17 g/mol. Its IUPAC name is [2-[3-(hydroxymethyl)anilino]-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[3-(hydroxymethyl)anilino]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 54125815 |
| Molecular Formula | C9H12NO5P |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | [2-[3-(hydroxymethyl)anilino]-2-oxoethyl]phosphonic acid |
| SMILES | O=C(CP(=O)(O)O)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C9H12NO5P/c11-5-7-2-1-3-8(4-7)10-9(12)6-16(13,14)15/h1-4,11H,5-6H2,(H,10,12)(H2,13,14,15) |
| InChIKey | NQWLXWOABWEHJM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|