C12H17NO3 — CID 78986765
N-[3-(hydroxymethyl)phenyl]-4-methoxybutanamide (PubChem CID 78986765) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)phenyl]-4-methoxybutanamide.
| Compound Name | N-[3-(hydroxymethyl)phenyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 78986765 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[3-(hydroxymethyl)phenyl]-4-methoxybutanamide |
| SMILES | COCCCC(=O)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C12H17NO3/c1-16-7-3-6-12(15)13-11-5-2-4-10(8-11)9-14/h2,4-5,8,14H,3,6-7,9H2,1H3,(H,13,15) |
| InChIKey | LAPUWPIKVDPFBC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|