C11H13NO2 — CID 62678719
N-[3-(hydroxymethyl)phenyl]but-3-enamide (PubChem CID 62678719) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)phenyl]but-3-enamide.
| Compound Name | N-[3-(hydroxymethyl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 62678719 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-[3-(hydroxymethyl)phenyl]but-3-enamide |
| SMILES | C=CCC(=O)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C11H13NO2/c1-2-4-11(14)12-10-6-3-5-9(7-10)8-13/h2-3,5-7,13H,1,4,8H2,(H,12,14) |
| InChIKey | ZEAIOUADCWAHTD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|