C12H17NO3S — CID 54897792
N-[3-(hydroxymethyl)phenyl]-2-(2-methoxyethylsulfanyl)acetamide (PubChem CID 54897792) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)phenyl]-2-(2-methoxyethylsulfanyl)acetamide.
| Compound Name | N-[3-(hydroxymethyl)phenyl]-2-(2-methoxyethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 54897792 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[3-(hydroxymethyl)phenyl]-2-(2-methoxyethylsulfanyl)acetamide |
| SMILES | COCCSCC(=O)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C12H17NO3S/c1-16-5-6-17-9-12(15)13-11-4-2-3-10(7-11)8-14/h2-4,7,14H,5-6,8-9H2,1H3,(H,13,15) |
| InChIKey | UOAVLJJXYLPISY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|