C13H17NO4S — CID 43423614
methyl 4-[[2-(2-methoxyethylsulfanyl)acetyl]amino]benzoate (PubChem CID 43423614) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 4-[[2-(2-methoxyethylsulfanyl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2-methoxyethylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43423614 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | methyl 4-[[2-(2-methoxyethylsulfanyl)acetyl]amino]benzoate |
| SMILES | COCCSCC(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C13H17NO4S/c1-17-7-8-19-9-12(15)14-11-5-3-10(4-6-11)13(16)18-2/h3-6H,7-9H2,1-2H3,(H,14,15) |
| InChIKey | WGIKTELGTZAWJY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|