C28H32N2O4 — CID 54076657
3,5-ditert-butyl-4-hydroxy-N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]benzamide (PubChem CID 54076657) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 54076657 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccc(C(=O)Nc3ccc(O)cc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H32N2O4/c1-27(2,3)22-15-18(16-23(24(22)32)28(4,5)6)26(34)30-19-9-7-17(8-10-19)25(33)29-20-11-13-21(31)14-12-20/h7-16,31-32H,1-6H3,(H,29,33)(H,30,34) |
| InChIKey | MKEKGXKBTUXSPQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|