C21H24Cl3NO2 — CID 134094104
3,5-ditert-butyl-4-hydroxy-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 134094104) has the molecular formula C21H24Cl3NO2 and a molecular weight of 428.79 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 134094104 |
| Molecular Formula | C21H24Cl3NO2 |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H24Cl3NO2/c1-20(2,3)12-7-11(8-13(18(12)26)21(4,5)6)19(27)25-17-10-15(23)14(22)9-16(17)24/h7-10,26H,1-6H3,(H,25,27) |
| InChIKey | OKNDWQJIVYLEMI-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|