C13H6Cl5NO — CID 17133480
3,5-dichloro-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 17133480) has the molecular formula C13H6Cl5NO and a molecular weight of 369.46 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 3,5-dichloro-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 17133480 |
| Molecular Formula | C13H6Cl5NO |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | 3,5-dichloro-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H6Cl5NO/c14-7-1-6(2-8(15)3-7)13(20)19-12-5-10(17)9(16)4-11(12)18/h1-5H,(H,19,20) |
| InChIKey | MPBUHBHIONCGFB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|