C15H11Cl4NO2 — CID 71362833
3,5-dichloro-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)benzamide (PubChem CID 71362833) has the molecular formula C15H11Cl4NO2 and a molecular weight of 379.07 g/mol. Its IUPAC name is 3,5-dichloro-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)benzamide.
| Compound Name | 3,5-dichloro-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 71362833 |
| Molecular Formula | C15H11Cl4NO2 |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 3,5-dichloro-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)benzamide |
| SMILES | CCc1c(Cl)cc(NC(=O)c2cc(Cl)cc(Cl)c2)c(O)c1Cl |
| InChI | InChI=1S/C15H11Cl4NO2/c1-2-10-11(18)6-12(14(21)13(10)19)20-15(22)7-3-8(16)5-9(17)4-7/h3-6,21H,2H2,1H3,(H,20,22) |
| InChIKey | UHUOFJUUOZIAFF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|