C16H15Cl2NO4 — CID 153343129
4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid;ethane (PubChem CID 153343129) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid;ethane.
| Compound Name | 4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid;ethane |
|---|---|
| PubChem CID | 153343129 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid;ethane |
| SMILES | CC.O=C(O)c1ccc(NC(=O)c2cc(Cl)cc(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C14H9Cl2NO4.C2H6/c15-9-3-8(4-10(16)6-9)13(19)17-11-2-1-7(14(20)21)5-12(11)18;1-2/h1-6,18H,(H,17,19)(H,20,21);1-2H3 |
| InChIKey | QTHIZBNMYMSEBN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|