C13H10Cl2N2O4 — CID 60826732
4-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-3-hydroxybenzoic acid (PubChem CID 60826732) has the molecular formula C13H10Cl2N2O4 and a molecular weight of 329.14 g/mol. Its IUPAC name is 4-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 60826732 |
| Molecular Formula | C13H10Cl2N2O4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-3-hydroxybenzoic acid |
| SMILES | Cn1c(C(=O)Nc2ccc(C(=O)O)cc2O)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H10Cl2N2O4/c1-17-9(5-7(14)11(17)15)12(19)16-8-3-2-6(13(20)21)4-10(8)18/h2-5,18H,1H3,(H,16,19)(H,20,21) |
| InChIKey | FWDQWFFGGSRQNM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|