C14H8Cl3NO4 — CID 108744147
3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid (PubChem CID 108744147) has the molecular formula C14H8Cl3NO4 and a molecular weight of 360.58 g/mol. Its IUPAC name is 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 108744147 |
| Molecular Formula | C14H8Cl3NO4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2c(Cl)ccc(Cl)c2Cl)c(O)c1 |
| InChI | InChI=1S/C14H8Cl3NO4/c15-7-2-3-8(16)12(17)11(7)13(20)18-9-4-1-6(14(21)22)5-10(9)19/h1-5,19H,(H,18,20)(H,21,22) |
| InChIKey | IRXJUEOTNVKENN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|