3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid

C14H8Cl3NO4 — CID 108744147

IUPAC3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2c(Cl)ccc(Cl)c2Cl)c(O)c1
InChIInChI=1S/C14H8Cl3NO4/c15-7-2-3-8(16)12(17)11(7)13(20)18-9-4-1-6(14(21)22)5-10(9)19/h1-5,19H,(H,18,20)(H,21,22)
InChIKeyIRXJUEOTNVKENN-UHFFFAOYSA-N
MW360.58 g/mol
LogP4.30
Rot. Bonds3

About 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid

3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid (PubChem CID 108744147) has the molecular formula C14H8Cl3NO4 and a molecular weight of 360.58 g/mol. Its IUPAC name is 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid
PubChem CID108744147
Molecular FormulaC14H8Cl3NO4
Molecular Weight360.58 g/mol
Exact Mass358.95
IUPAC Name3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2c(Cl)ccc(Cl)c2Cl)c(O)c1
InChIInChI=1S/C14H8Cl3NO4/c15-7-2-3-8(16)12(17)11(7)13(20)18-9-4-1-6(14(21)22)5-10(9)19/h1-5,19H,(H,18,20)(H,21,22)
InChIKeyIRXJUEOTNVKENN-UHFFFAOYSA-N
XLogP4.30
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.58
LogP ≤ 54.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid?
The IUPAC name of 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid (CID 108744147) is 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid.
What is the SMILES notation for 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid?
The canonical SMILES for 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid is O=C(O)c1ccc(NC(=O)c2c(Cl)ccc(Cl)c2Cl)c(O)c1.
What is the InChIKey of 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid?
The InChIKey is IRXJUEOTNVKENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl3NO4/c15-7-2-3-8(16)12(17)11(7)13(20)18-9-4-1-6(14(21)22)5-10(9)19/h1-5,19H,(H,18,20)(H,21,22).
What are the key properties of 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid?
3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid has a molecular weight of 360.58 g/mol, XLogP of 4.30, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-[(2,3,6-trichlorobenzoyl)amino]benzoic acid is sourced from PubChem (CID 108744147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).