C18H19NO4 — CID 108744180
4-[(4-tert-butylbenzoyl)amino]-3-hydroxybenzoic acid (PubChem CID 108744180) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-[(4-tert-butylbenzoyl)amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(4-tert-butylbenzoyl)amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108744180 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-[(4-tert-butylbenzoyl)amino]-3-hydroxybenzoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)O)cc2O)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-18(2,3)13-7-4-11(5-8-13)16(21)19-14-9-6-12(17(22)23)10-15(14)20/h4-10,20H,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | LVCAULZGRVTBDU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|