C14H10FNO5 — CID 107728087
4-[(3,4-dihydroxybenzoyl)amino]-3-fluorobenzoic acid (PubChem CID 107728087) has the molecular formula C14H10FNO5 and a molecular weight of 291.23 g/mol. Its IUPAC name is 4-[(3,4-dihydroxybenzoyl)amino]-3-fluorobenzoic acid.
| Compound Name | 4-[(3,4-dihydroxybenzoyl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107728087 |
| Molecular Formula | C14H10FNO5 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-[(3,4-dihydroxybenzoyl)amino]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(O)c(O)c2)c(F)c1 |
| InChI | InChI=1S/C14H10FNO5/c15-9-5-8(14(20)21)1-3-10(9)16-13(19)7-2-4-11(17)12(18)6-7/h1-6,17-18H,(H,16,19)(H,20,21) |
| InChIKey | ZYKBMKPDGSSXOM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|