C13H9NO6 — CID 60827184
3-hydroxy-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid (PubChem CID 60827184) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is 3-hydroxy-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 60827184 |
| Molecular Formula | C13H9NO6 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-hydroxy-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(=O)oc2)c(O)c1 |
| InChI | InChI=1S/C13H9NO6/c15-10-5-7(13(18)19)1-3-9(10)14-12(17)8-2-4-11(16)20-6-8/h1-6,15H,(H,14,17)(H,18,19) |
| InChIKey | JGFRTOBSVZDEND-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|