C15H12ClNO5 — CID 58230869
4-[(2-chloro-4-methoxybenzoyl)amino]-3-hydroxybenzoic acid (PubChem CID 58230869) has the molecular formula C15H12ClNO5 and a molecular weight of 321.72 g/mol. Its IUPAC name is 4-[(2-chloro-4-methoxybenzoyl)amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(2-chloro-4-methoxybenzoyl)amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 58230869 |
| Molecular Formula | C15H12ClNO5 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[(2-chloro-4-methoxybenzoyl)amino]-3-hydroxybenzoic acid |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)O)cc2O)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClNO5/c1-22-9-3-4-10(11(16)7-9)14(19)17-12-5-2-8(15(20)21)6-13(12)18/h2-7,18H,1H3,(H,17,19)(H,20,21) |
| InChIKey | NMVWMOYZZGIFTJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|