C15H11N3O8 — CID 108744179
3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoic acid (PubChem CID 108744179) has the molecular formula C15H11N3O8 and a molecular weight of 361.27 g/mol. Its IUPAC name is 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 108744179 |
| Molecular Formula | C15H11N3O8 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoic acid |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)Nc2ccc(C(=O)O)cc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N3O8/c1-7-11(17(23)24)4-9(5-12(7)18(25)26)14(20)16-10-3-2-8(15(21)22)6-13(10)19/h2-6,19H,1H3,(H,16,20)(H,21,22) |
| InChIKey | GYWFFLKUNCCAAI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 172.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|