C16H13N3O8 — CID 108744835
methyl 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate (PubChem CID 108744835) has the molecular formula C16H13N3O8 and a molecular weight of 375.29 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate.
| Compound Name | methyl 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 108744835 |
| Molecular Formula | C16H13N3O8 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | methyl 3-hydroxy-4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)c(O)c1 |
| InChI | InChI=1S/C16H13N3O8/c1-8-12(18(23)24)5-10(6-13(8)19(25)26)15(21)17-11-4-3-9(7-14(11)20)16(22)27-2/h3-7,20H,1-2H3,(H,17,21) |
| InChIKey | QVVJIZXBYWICOX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|