C16H14N2O8 — CID 108744160
4-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-3-hydroxybenzoic acid (PubChem CID 108744160) has the molecular formula C16H14N2O8 and a molecular weight of 362.29 g/mol. Its IUPAC name is 4-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108744160 |
| Molecular Formula | C16H14N2O8 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-3-hydroxybenzoic acid |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)O)cc2O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H14N2O8/c1-25-13-6-9(11(18(23)24)7-14(13)26-2)15(20)17-10-4-3-8(16(21)22)5-12(10)19/h3-7,19H,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | VRUMMXJKBVKUGV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|