C15H13Cl2NO2 — CID 107675698
N-(3,5-dichloro-2-hydroxyphenyl)-3,5-dimethylbenzamide (PubChem CID 107675698) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-3,5-dimethylbenzamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 107675698 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C15H13Cl2NO2/c1-8-3-9(2)5-10(4-8)15(20)18-13-7-11(16)6-12(17)14(13)19/h3-7,19H,1-2H3,(H,18,20) |
| InChIKey | ZIDDDXDQAMJMGU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|