C13H9Cl2NO3 — CID 3067488
N-(3,5-dichloro-2-hydroxyphenyl)-2-hydroxybenzamide (PubChem CID 3067488) has the molecular formula C13H9Cl2NO3 and a molecular weight of 298.12 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-2-hydroxybenzamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 3067488 |
| Molecular Formula | C13H9Cl2NO3 |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-2-hydroxybenzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1O)c1ccccc1O |
| InChI | InChI=1S/C13H9Cl2NO3/c14-7-5-9(15)12(18)10(6-7)16-13(19)8-3-1-2-4-11(8)17/h1-6,17-18H,(H,16,19) |
| InChIKey | OGGDKKRKBCZXHR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|