C15H9Cl2NO3 — CID 103891115
N-(3,5-dichloro-2-hydroxyphenyl)-1-benzofuran-2-carboxamide (PubChem CID 103891115) has the molecular formula C15H9Cl2NO3 and a molecular weight of 322.15 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 103891115 |
| Molecular Formula | C15H9Cl2NO3 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H9Cl2NO3/c16-9-6-10(17)14(19)11(7-9)18-15(20)13-5-8-3-1-2-4-12(8)21-13/h1-7,19H,(H,18,20) |
| InChIKey | ZCCSKJWYMZGBPM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|