C22H14Cl2N2O3 — CID 1107583
N-[4-[(2,4-dichlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 1107583) has the molecular formula C22H14Cl2N2O3 and a molecular weight of 425.27 g/mol. Its IUPAC name is N-[4-[(2,4-dichlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(2,4-dichlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1107583 |
| Molecular Formula | C22H14Cl2N2O3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[4-[(2,4-dichlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H14Cl2N2O3/c23-14-5-10-17(18(24)12-14)21(27)25-15-6-8-16(9-7-15)26-22(28)20-11-13-3-1-2-4-19(13)29-20/h1-12H,(H,25,27)(H,26,28) |
| InChIKey | XNYUJJVHLBBFFO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |