C22H15ClN2O3 — CID 1136389
N-[3-[(3-chlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 1136389) has the molecular formula C22H15ClN2O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is N-[3-[(3-chlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[(3-chlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1136389 |
| Molecular Formula | C22H15ClN2O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[3-[(3-chlorobenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2cc3ccccc3o2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClN2O3/c23-16-7-3-6-15(11-16)21(26)24-17-8-4-9-18(13-17)25-22(27)20-12-14-5-1-2-10-19(14)28-20/h1-13H,(H,24,26)(H,25,27) |
| InChIKey | DWBPSGLGFNILQK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |