C26H24N2O3 — CID 22775944
N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 22775944) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 22775944 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=O)c3cc4ccccc4o3)c2)cc1 |
| InChI | InChI=1S/C26H24N2O3/c1-26(2,3)19-13-11-17(12-14-19)24(29)27-20-8-6-9-21(16-20)28-25(30)23-15-18-7-4-5-10-22(18)31-23/h4-16H,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | VGJUZCFGNYHXNI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |