C33H28N2O4 — CID 3659488
N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 3659488) has the molecular formula C33H28N2O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 3659488 |
| Molecular Formula | C33H28N2O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(NC(=O)c3cccc(-c4cc5ccccc5oc4=O)c3)cc2)cc1 |
| InChI | InChI=1S/C33H28N2O4/c1-33(2,3)25-13-11-21(12-14-25)30(36)34-26-15-17-27(18-16-26)35-31(37)24-9-6-8-22(19-24)28-20-23-7-4-5-10-29(23)39-32(28)38/h4-20H,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | DVBGZMAWMMTAFJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|