C23H16BrN3O3S — CID 17112130
N-[3-[(3-bromobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17112130) has the molecular formula C23H16BrN3O3S and a molecular weight of 494.37 g/mol. Its IUPAC name is N-[3-[(3-bromobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[(3-bromobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17112130 |
| Molecular Formula | C23H16BrN3O3S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | N-[3-[(3-bromobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(NC(=O)c2cc3ccccc3o2)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H16BrN3O3S/c24-16-7-3-6-15(11-16)21(28)27-23(31)26-18-9-4-8-17(13-18)25-22(29)20-12-14-5-1-2-10-19(14)30-20/h1-13H,(H,25,29)(H2,26,27,28,31) |
| InChIKey | FQTLWNAEBFPXJQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|